C18H22N2O — CID 80649456
4-ethoxy-N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)aniline (PubChem CID 80649456) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is 4-ethoxy-N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)aniline.
| Compound Name | 4-ethoxy-N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)aniline |
|---|---|
| PubChem CID | 80649456 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 4-ethoxy-N-(1,2,3,4-tetrahydroquinolin-8-ylmethyl)aniline |
| SMILES | CCOc1ccc(NCc2cccc3c2NCCC3)cc1 |
| InChI | InChI=1S/C18H22N2O/c1-2-21-17-10-8-16(9-11-17)20-13-15-6-3-5-14-7-4-12-19-18(14)15/h3,5-6,8-11,19-20H,2,4,7,12-13H2,1H3 |
| InChIKey | JAWXOLHEQKWUNV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|