C13H18N2O2 — CID 80649501
4-(2,3-dihydro-1H-indol-7-ylmethylamino)butanoic acid (PubChem CID 80649501) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 4-(2,3-dihydro-1H-indol-7-ylmethylamino)butanoic acid.
| Compound Name | 4-(2,3-dihydro-1H-indol-7-ylmethylamino)butanoic acid |
|---|---|
| PubChem CID | 80649501 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 4-(2,3-dihydro-1H-indol-7-ylmethylamino)butanoic acid |
| SMILES | O=C(O)CCCNCc1cccc2c1NCC2 |
| InChI | InChI=1S/C13H18N2O2/c16-12(17)5-2-7-14-9-11-4-1-3-10-6-8-15-13(10)11/h1,3-4,14-15H,2,5-9H2,(H,16,17) |
| InChIKey | SXHMYJNCLNEGQW-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|