C13H17ClN2O4S — CID 171133307
8-chloro-N-(3-methoxypropyl)-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonamide (PubChem CID 171133307) has the molecular formula C13H17ClN2O4S and a molecular weight of 332.81 g/mol. Its IUPAC name is 8-chloro-N-(3-methoxypropyl)-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonamide.
| Compound Name | 8-chloro-N-(3-methoxypropyl)-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 171133307 |
| Molecular Formula | C13H17ClN2O4S |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 8-chloro-N-(3-methoxypropyl)-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonamide |
| SMILES | COCCCNS(=O)(=O)c1cc(Cl)c2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C13H17ClN2O4S/c1-20-6-2-5-15-21(18,19)10-7-9-3-4-12(17)16-13(9)11(14)8-10/h7-8,15H,2-6H2,1H3,(H,16,17) |
| InChIKey | QHRDTWOEBIVQEZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|