6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-8-carboxylic acid

C10H8FNO3 — CID 82104959

IUPAC6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-8-carboxylic acid
SMILESO=C1CCc2cc(F)cc(C(=O)O)c2N1
InChIInChI=1S/C10H8FNO3/c11-6-3-5-1-2-8(13)12-9(5)7(4-6)10(14)15/h3-4H,1-2H2,(H,12,13)(H,14,15)
InChIKeyNQVZQPFQYZJYQP-UHFFFAOYSA-N
MW209.18 g/mol
LogP1.41
Rot. Bonds1

About 6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-8-carboxylic acid

6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-8-carboxylic acid (PubChem CID 82104959) has the molecular formula C10H8FNO3 and a molecular weight of 209.18 g/mol. Its IUPAC name is 6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-8-carboxylic acid.

Molecular Properties

Compound Name6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-8-carboxylic acid
PubChem CID82104959
Molecular FormulaC10H8FNO3
Molecular Weight209.18 g/mol
Exact Mass209.05
IUPAC Name6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-8-carboxylic acid
SMILESO=C1CCc2cc(F)cc(C(=O)O)c2N1
InChIInChI=1S/C10H8FNO3/c11-6-3-5-1-2-8(13)12-9(5)7(4-6)10(14)15/h3-4H,1-2H2,(H,12,13)(H,14,15)
InChIKeyNQVZQPFQYZJYQP-UHFFFAOYSA-N
XLogP1.41
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.18
LogP ≤ 51.41
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-8-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-8-carboxylic acid?
The IUPAC name of 6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-8-carboxylic acid (CID 82104959) is 6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-8-carboxylic acid.
What is the SMILES notation for 6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-8-carboxylic acid?
The canonical SMILES for 6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-8-carboxylic acid is O=C1CCc2cc(F)cc(C(=O)O)c2N1.
What is the InChIKey of 6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-8-carboxylic acid?
The InChIKey is NQVZQPFQYZJYQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8FNO3/c11-6-3-5-1-2-8(13)12-9(5)7(4-6)10(14)15/h3-4H,1-2H2,(H,12,13)(H,14,15).
What are the key properties of 6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-8-carboxylic acid?
6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-8-carboxylic acid has a molecular weight of 209.18 g/mol, XLogP of 1.41, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-2-oxo-3,4-dihydro-1H-quinoline-8-carboxylic acid is sourced from PubChem (CID 82104959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).