C16H20ClFN4O2 — CID 154900986
(3aR,6aS)-N-(6-fluoro-2-oxo-3,4-dihydro-1H-quinolin-8-yl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxamide;hydrochloride (PubChem CID 154900986) has the molecular formula C16H20ClFN4O2 and a molecular weight of 354.81 g/mol. Its IUPAC name is (3aR,6aS)-N-(6-fluoro-2-oxo-3,4-dihydro-1H-quinolin-8-yl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxamide;hydrochloride.
| Compound Name | (3aR,6aS)-N-(6-fluoro-2-oxo-3,4-dihydro-1H-quinolin-8-yl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 154900986 |
| Molecular Formula | C16H20ClFN4O2 |
| Molecular Weight | 354.81 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | (3aR,6aS)-N-(6-fluoro-2-oxo-3,4-dihydro-1H-quinolin-8-yl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxamide;hydrochloride |
| SMILES | Cl.O=C1CCc2cc(F)cc(NC(=O)N3C[C@H]4CNC[C@H]4C3)c2N1 |
| InChI | InChI=1S/C16H19FN4O2.ClH/c17-12-3-9-1-2-14(22)20-15(9)13(4-12)19-16(23)21-7-10-5-18-6-11(10)8-21;/h3-4,10-11,18H,1-2,5-8H2,(H,19,23)(H,20,22);1H/t10-,11+; |
| InChIKey | ZBQPKMKCLRNSFI-NJJJQDLFSA-N |
| XLogP | 1.82 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.81 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |