C13H9FN4O — CID 168544192
2-[[(6-fluoro-2-oxo-3,4-dihydro-1H-quinolin-8-yl)amino]methylidene]propanedinitrile (PubChem CID 168544192) has the molecular formula C13H9FN4O and a molecular weight of 256.24 g/mol. Its IUPAC name is 2-[[(6-fluoro-2-oxo-3,4-dihydro-1H-quinolin-8-yl)amino]methylidene]propanedinitrile.
| Compound Name | 2-[[(6-fluoro-2-oxo-3,4-dihydro-1H-quinolin-8-yl)amino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168544192 |
| Molecular Formula | C13H9FN4O |
| Molecular Weight | 256.24 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 2-[[(6-fluoro-2-oxo-3,4-dihydro-1H-quinolin-8-yl)amino]methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=CNc1cc(F)cc2c1NC(=O)CC2 |
| InChI | InChI=1S/C13H9FN4O/c14-10-3-9-1-2-12(19)18-13(9)11(4-10)17-7-8(5-15)6-16/h3-4,7,17H,1-2H2,(H,18,19) |
| InChIKey | SLNICMZESUMPAT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|