C9H7FN2O3 — CID 51138330
6-fluoro-8-nitro-3,4-dihydro-1H-quinolin-2-one (PubChem CID 51138330) has the molecular formula C9H7FN2O3 and a molecular weight of 210.16 g/mol. Its IUPAC name is 6-fluoro-8-nitro-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-fluoro-8-nitro-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 51138330 |
| Molecular Formula | C9H7FN2O3 |
| Molecular Weight | 210.16 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 6-fluoro-8-nitro-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(F)cc([N+](=O)[O-])c2N1 |
| InChI | InChI=1S/C9H7FN2O3/c10-6-3-5-1-2-8(13)11-9(5)7(4-6)12(14)15/h3-4H,1-2H2,(H,11,13) |
| InChIKey | JWAKJRPZAXKJKN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.16 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|