C10H11FN2O2 — CID 92982227
(2R)-6-fluoro-2-methyl-8-nitro-1,2,3,4-tetrahydroquinoline (PubChem CID 92982227) has the molecular formula C10H11FN2O2 and a molecular weight of 210.21 g/mol. Its IUPAC name is (2R)-6-fluoro-2-methyl-8-nitro-1,2,3,4-tetrahydroquinoline.
| Compound Name | (2R)-6-fluoro-2-methyl-8-nitro-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 92982227 |
| Molecular Formula | C10H11FN2O2 |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | (2R)-6-fluoro-2-methyl-8-nitro-1,2,3,4-tetrahydroquinoline |
| SMILES | C[C@@H]1CCc2cc(F)cc([N+](=O)[O-])c2N1 |
| InChI | InChI=1S/C10H11FN2O2/c1-6-2-3-7-4-8(11)5-9(13(14)15)10(7)12-6/h4-6,12H,2-3H2,1H3/t6-/m1/s1 |
| InChIKey | ZKBYYUCLCRPWFR-ZCFIWIBFSA-N |
| XLogP | 2.48 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|