C14H18N2O3 — CID 7053327
4-[(2S)-2-methyl-6-nitro-1,2,3,4-tetrahydroquinolin-7-yl]butan-2-one (PubChem CID 7053327) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 4-[(2S)-2-methyl-6-nitro-1,2,3,4-tetrahydroquinolin-7-yl]butan-2-one.
| Compound Name | 4-[(2S)-2-methyl-6-nitro-1,2,3,4-tetrahydroquinolin-7-yl]butan-2-one |
|---|---|
| PubChem CID | 7053327 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 4-[(2S)-2-methyl-6-nitro-1,2,3,4-tetrahydroquinolin-7-yl]butan-2-one |
| SMILES | CC(=O)CCc1cc2c(cc1[N+](=O)[O-])CC[C@H](C)N2 |
| InChI | InChI=1S/C14H18N2O3/c1-9-3-5-11-8-14(16(18)19)12(6-4-10(2)17)7-13(11)15-9/h7-9,15H,3-6H2,1-2H3/t9-/m0/s1 |
| InChIKey | BRUCOLSMZREDPO-VIFPVBQESA-N |
| XLogP | 2.86 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|