C13H15N3O5 — CID 122059567
3-[methyl-(6-nitro-2-oxo-3,4-dihydro-1H-quinolin-7-yl)amino]propanoic acid (PubChem CID 122059567) has the molecular formula C13H15N3O5 and a molecular weight of 293.28 g/mol. Its IUPAC name is 3-[methyl-(6-nitro-2-oxo-3,4-dihydro-1H-quinolin-7-yl)amino]propanoic acid.
| Compound Name | 3-[methyl-(6-nitro-2-oxo-3,4-dihydro-1H-quinolin-7-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 122059567 |
| Molecular Formula | C13H15N3O5 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 3-[methyl-(6-nitro-2-oxo-3,4-dihydro-1H-quinolin-7-yl)amino]propanoic acid |
| SMILES | CN(CCC(=O)O)c1cc2c(cc1[N+](=O)[O-])CCC(=O)N2 |
| InChI | InChI=1S/C13H15N3O5/c1-15(5-4-13(18)19)10-7-9-8(2-3-12(17)14-9)6-11(10)16(20)21/h6-7H,2-5H2,1H3,(H,14,17)(H,18,19) |
| InChIKey | XPZWNPQKCMPTPZ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|