C17H22N4O5 — CID 122062108
2-[ethyl-[3-[(6-nitro-2-oxo-3,4-dihydro-1H-quinolin-7-yl)amino]cyclobutyl]amino]acetic acid (PubChem CID 122062108) has the molecular formula C17H22N4O5 and a molecular weight of 362.39 g/mol. Its IUPAC name is 2-[ethyl-[3-[(6-nitro-2-oxo-3,4-dihydro-1H-quinolin-7-yl)amino]cyclobutyl]amino]acetic acid.
| Compound Name | 2-[ethyl-[3-[(6-nitro-2-oxo-3,4-dihydro-1H-quinolin-7-yl)amino]cyclobutyl]amino]acetic acid |
|---|---|
| PubChem CID | 122062108 |
| Molecular Formula | C17H22N4O5 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 2-[ethyl-[3-[(6-nitro-2-oxo-3,4-dihydro-1H-quinolin-7-yl)amino]cyclobutyl]amino]acetic acid |
| SMILES | CCN(CC(=O)O)C1CC(Nc2cc3c(cc2[N+](=O)[O-])CCC(=O)N3)C1 |
| InChI | InChI=1S/C17H22N4O5/c1-2-20(9-17(23)24)12-6-11(7-12)18-14-8-13-10(3-4-16(22)19-13)5-15(14)21(25)26/h5,8,11-12,18H,2-4,6-7,9H2,1H3,(H,19,22)(H,23,24) |
| InChIKey | LSSBNIHFVRYWPT-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 124.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|