C16H22N4O5 — CID 122061945
2-[ethyl-[3-[2-(methylcarbamoyl)-4-nitroanilino]cyclobutyl]amino]acetic acid (PubChem CID 122061945) has the molecular formula C16H22N4O5 and a molecular weight of 350.38 g/mol. Its IUPAC name is 2-[ethyl-[3-[2-(methylcarbamoyl)-4-nitroanilino]cyclobutyl]amino]acetic acid.
| Compound Name | 2-[ethyl-[3-[2-(methylcarbamoyl)-4-nitroanilino]cyclobutyl]amino]acetic acid |
|---|---|
| PubChem CID | 122061945 |
| Molecular Formula | C16H22N4O5 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 2-[ethyl-[3-[2-(methylcarbamoyl)-4-nitroanilino]cyclobutyl]amino]acetic acid |
| SMILES | CCN(CC(=O)O)C1CC(Nc2ccc([N+](=O)[O-])cc2C(=O)NC)C1 |
| InChI | InChI=1S/C16H22N4O5/c1-3-19(9-15(21)22)12-6-10(7-12)18-14-5-4-11(20(24)25)8-13(14)16(23)17-2/h4-5,8,10,12,18H,3,6-7,9H2,1-2H3,(H,17,23)(H,21,22) |
| InChIKey | MTULRGXLIDIGCF-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 124.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|