C17H22FN3O6 — CID 122061868
2-[[3-(2-ethoxycarbonyl-6-fluoro-4-nitroanilino)cyclobutyl]-ethylamino]acetic acid (PubChem CID 122061868) has the molecular formula C17H22FN3O6 and a molecular weight of 383.38 g/mol. Its IUPAC name is 2-[[3-(2-ethoxycarbonyl-6-fluoro-4-nitroanilino)cyclobutyl]-ethylamino]acetic acid.
| Compound Name | 2-[[3-(2-ethoxycarbonyl-6-fluoro-4-nitroanilino)cyclobutyl]-ethylamino]acetic acid |
|---|---|
| PubChem CID | 122061868 |
| Molecular Formula | C17H22FN3O6 |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 2-[[3-(2-ethoxycarbonyl-6-fluoro-4-nitroanilino)cyclobutyl]-ethylamino]acetic acid |
| SMILES | CCOC(=O)c1cc([N+](=O)[O-])cc(F)c1NC1CC(N(CC)CC(=O)O)C1 |
| InChI | InChI=1S/C17H22FN3O6/c1-3-20(9-15(22)23)11-5-10(6-11)19-16-13(17(24)27-4-2)7-12(21(25)26)8-14(16)18/h7-8,10-11,19H,3-6,9H2,1-2H3,(H,22,23) |
| InChIKey | PFPGHQPFVFPIRT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|