C16H22N4O6 — CID 122062067
2-[[3-[(4-ethoxycarbonyl-3-nitro-2-pyridinyl)amino]cyclobutyl]-ethylamino]acetic acid (PubChem CID 122062067) has the molecular formula C16H22N4O6 and a molecular weight of 366.37 g/mol. Its IUPAC name is 2-[[3-[(4-ethoxycarbonyl-3-nitro-2-pyridinyl)amino]cyclobutyl]-ethylamino]acetic acid.
| Compound Name | 2-[[3-[(4-ethoxycarbonyl-3-nitro-2-pyridinyl)amino]cyclobutyl]-ethylamino]acetic acid |
|---|---|
| PubChem CID | 122062067 |
| Molecular Formula | C16H22N4O6 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 2-[[3-[(4-ethoxycarbonyl-3-nitro-2-pyridinyl)amino]cyclobutyl]-ethylamino]acetic acid |
| SMILES | CCOC(=O)c1ccnc(NC2CC(N(CC)CC(=O)O)C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H22N4O6/c1-3-19(9-13(21)22)11-7-10(8-11)18-15-14(20(24)25)12(5-6-17-15)16(23)26-4-2/h5-6,10-11H,3-4,7-9H2,1-2H3,(H,17,18)(H,21,22) |
| InChIKey | FFOQPPDDFRZZQC-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 134.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|