C18H17F2N3O5 — CID 133435286
ethyl 2-[[2-(3,4-difluorophenyl)oxolan-3-yl]amino]-3-nitropyridine-4-carboxylate (PubChem CID 133435286) has the molecular formula C18H17F2N3O5 and a molecular weight of 393.35 g/mol. Its IUPAC name is ethyl 2-[[2-(3,4-difluorophenyl)oxolan-3-yl]amino]-3-nitropyridine-4-carboxylate.
| Compound Name | ethyl 2-[[2-(3,4-difluorophenyl)oxolan-3-yl]amino]-3-nitropyridine-4-carboxylate |
|---|---|
| PubChem CID | 133435286 |
| Molecular Formula | C18H17F2N3O5 |
| Molecular Weight | 393.35 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | ethyl 2-[[2-(3,4-difluorophenyl)oxolan-3-yl]amino]-3-nitropyridine-4-carboxylate |
| SMILES | CCOC(=O)c1ccnc(NC2CCOC2c2ccc(F)c(F)c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H17F2N3O5/c1-2-27-18(24)11-5-7-21-17(15(11)23(25)26)22-14-6-8-28-16(14)10-3-4-12(19)13(20)9-10/h3-5,7,9,14,16H,2,6,8H2,1H3,(H,21,22) |
| InChIKey | VYLHPXIJPXMKHM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|