C16H15F2N3O3 — CID 124626280
3-N-[(2R,3S)-2-(3,4-difluorophenyl)oxolan-3-yl]-4-nitrobenzene-1,3-diamine (PubChem CID 124626280) has the molecular formula C16H15F2N3O3 and a molecular weight of 335.31 g/mol. Its IUPAC name is 3-N-[(2R,3S)-2-(3,4-difluorophenyl)oxolan-3-yl]-4-nitrobenzene-1,3-diamine.
| Compound Name | 3-N-[(2R,3S)-2-(3,4-difluorophenyl)oxolan-3-yl]-4-nitrobenzene-1,3-diamine |
|---|---|
| PubChem CID | 124626280 |
| Molecular Formula | C16H15F2N3O3 |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 3-N-[(2R,3S)-2-(3,4-difluorophenyl)oxolan-3-yl]-4-nitrobenzene-1,3-diamine |
| SMILES | Nc1ccc([N+](=O)[O-])c(N[C@H]2CCO[C@@H]2c2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C16H15F2N3O3/c17-11-3-1-9(7-12(11)18)16-13(5-6-24-16)20-14-8-10(19)2-4-15(14)21(22)23/h1-4,7-8,13,16,20H,5-6,19H2/t13-,16+/m0/s1 |
| InChIKey | NVBZADBYSRFZDR-XJKSGUPXSA-N |
| XLogP | 3.40 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|