C17H16F2N2O5S — CID 133435348
2-(3,4-difluorophenyl)-N-(4-methylsulfonyl-2-nitrophenyl)oxolan-3-amine (PubChem CID 133435348) has the molecular formula C17H16F2N2O5S and a molecular weight of 398.39 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-N-(4-methylsulfonyl-2-nitrophenyl)oxolan-3-amine.
| Compound Name | 2-(3,4-difluorophenyl)-N-(4-methylsulfonyl-2-nitrophenyl)oxolan-3-amine |
|---|---|
| PubChem CID | 133435348 |
| Molecular Formula | C17H16F2N2O5S |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 2-(3,4-difluorophenyl)-N-(4-methylsulfonyl-2-nitrophenyl)oxolan-3-amine |
| SMILES | CS(=O)(=O)c1ccc(NC2CCOC2c2ccc(F)c(F)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H16F2N2O5S/c1-27(24,25)11-3-5-14(16(9-11)21(22)23)20-15-6-7-26-17(15)10-2-4-12(18)13(19)8-10/h2-5,8-9,15,17,20H,6-7H2,1H3 |
| InChIKey | OGSPKQBRJWFPRI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|