C20H21F2N3O4 — CID 133435316
4-[[2-(3,4-difluorophenyl)oxolan-3-yl]amino]-3-nitro-N-propan-2-ylbenzamide (PubChem CID 133435316) has the molecular formula C20H21F2N3O4 and a molecular weight of 405.40 g/mol. Its IUPAC name is 4-[[2-(3,4-difluorophenyl)oxolan-3-yl]amino]-3-nitro-N-propan-2-ylbenzamide.
| Compound Name | 4-[[2-(3,4-difluorophenyl)oxolan-3-yl]amino]-3-nitro-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 133435316 |
| Molecular Formula | C20H21F2N3O4 |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 4-[[2-(3,4-difluorophenyl)oxolan-3-yl]amino]-3-nitro-N-propan-2-ylbenzamide |
| SMILES | CC(C)NC(=O)c1ccc(NC2CCOC2c2ccc(F)c(F)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H21F2N3O4/c1-11(2)23-20(26)13-4-6-16(18(10-13)25(27)28)24-17-7-8-29-19(17)12-3-5-14(21)15(22)9-12/h3-6,9-11,17,19,24H,7-8H2,1-2H3,(H,23,26) |
| InChIKey | IUZCRIFLLMRTKP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|