C19H18F2N4O4 — CID 55502261
4-(cyclopropylamino)-N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]-3-nitrobenzamide (PubChem CID 55502261) has the molecular formula C19H18F2N4O4 and a molecular weight of 404.37 g/mol. Its IUPAC name is 4-(cyclopropylamino)-N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]-3-nitrobenzamide.
| Compound Name | 4-(cyclopropylamino)-N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 55502261 |
| Molecular Formula | C19H18F2N4O4 |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 4-(cyclopropylamino)-N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]-3-nitrobenzamide |
| SMILES | CNC(=O)C(NC(=O)c1ccc(NC2CC2)c([N+](=O)[O-])c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H18F2N4O4/c1-22-19(27)17(10-2-6-13(20)14(21)8-10)24-18(26)11-3-7-15(23-12-4-5-12)16(9-11)25(28)29/h2-3,6-9,12,17,23H,4-5H2,1H3,(H,22,27)(H,24,26) |
| InChIKey | QHFFEEVZHBIQEH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|