C14H13ClF2N4O — CID 133435463
6-chloro-4-N-[2-(3,4-difluorophenyl)oxolan-3-yl]pyrimidine-2,4-diamine (PubChem CID 133435463) has the molecular formula C14H13ClF2N4O and a molecular weight of 326.73 g/mol. Its IUPAC name is 6-chloro-4-N-[2-(3,4-difluorophenyl)oxolan-3-yl]pyrimidine-2,4-diamine.
| Compound Name | 6-chloro-4-N-[2-(3,4-difluorophenyl)oxolan-3-yl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 133435463 |
| Molecular Formula | C14H13ClF2N4O |
| Molecular Weight | 326.73 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 6-chloro-4-N-[2-(3,4-difluorophenyl)oxolan-3-yl]pyrimidine-2,4-diamine |
| SMILES | Nc1nc(Cl)cc(NC2CCOC2c2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C14H13ClF2N4O/c15-11-6-12(21-14(18)20-11)19-10-3-4-22-13(10)7-1-2-8(16)9(17)5-7/h1-2,5-6,10,13H,3-4H2,(H3,18,19,20,21) |
| InChIKey | AOUDSZKCSXHTOK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.73 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |