C15H17ClN4O — CID 133353479
6-chloro-4-N-[(2-phenyloxolan-3-yl)methyl]pyrimidine-2,4-diamine (PubChem CID 133353479) has the molecular formula C15H17ClN4O and a molecular weight of 304.78 g/mol. Its IUPAC name is 6-chloro-4-N-[(2-phenyloxolan-3-yl)methyl]pyrimidine-2,4-diamine.
| Compound Name | 6-chloro-4-N-[(2-phenyloxolan-3-yl)methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 133353479 |
| Molecular Formula | C15H17ClN4O |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 6-chloro-4-N-[(2-phenyloxolan-3-yl)methyl]pyrimidine-2,4-diamine |
| SMILES | Nc1nc(Cl)cc(NCC2CCOC2c2ccccc2)n1 |
| InChI | InChI=1S/C15H17ClN4O/c16-12-8-13(20-15(17)19-12)18-9-11-6-7-21-14(11)10-4-2-1-3-5-10/h1-5,8,11,14H,6-7,9H2,(H3,17,18,19,20) |
| InChIKey | AFGPHNXOSBGSOQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |