C18H17ClN2O — CID 133353309
4-chloro-2-[(2-phenyloxolan-3-yl)methylamino]benzonitrile (PubChem CID 133353309) has the molecular formula C18H17ClN2O and a molecular weight of 312.80 g/mol. Its IUPAC name is 4-chloro-2-[(2-phenyloxolan-3-yl)methylamino]benzonitrile.
| Compound Name | 4-chloro-2-[(2-phenyloxolan-3-yl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 133353309 |
| Molecular Formula | C18H17ClN2O |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 4-chloro-2-[(2-phenyloxolan-3-yl)methylamino]benzonitrile |
| SMILES | N#Cc1ccc(Cl)cc1NCC1CCOC1c1ccccc1 |
| InChI | InChI=1S/C18H17ClN2O/c19-16-7-6-14(11-20)17(10-16)21-12-15-8-9-22-18(15)13-4-2-1-3-5-13/h1-7,10,15,18,21H,8-9,12H2 |
| InChIKey | JMOQYUOWOHRCDS-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |