C18H18N4O3 — CID 129488556
5-nitro-2-[[(2S,3R)-2-phenyloxan-3-yl]methylamino]pyridine-3-carbonitrile (PubChem CID 129488556) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is 5-nitro-2-[[(2S,3R)-2-phenyloxan-3-yl]methylamino]pyridine-3-carbonitrile.
| Compound Name | 5-nitro-2-[[(2S,3R)-2-phenyloxan-3-yl]methylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 129488556 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 5-nitro-2-[[(2S,3R)-2-phenyloxan-3-yl]methylamino]pyridine-3-carbonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])cnc1NC[C@H]1CCCO[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C18H18N4O3/c19-10-15-9-16(22(23)24)12-21-18(15)20-11-14-7-4-8-25-17(14)13-5-2-1-3-6-13/h1-3,5-6,9,12,14,17H,4,7-8,11H2,(H,20,21)/t14-,17-/m1/s1 |
| InChIKey | JCCOTOPBSHPPFN-RHSMWYFYSA-N |
| XLogP | 3.44 |
| TPSA | 101.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|