C18H20ClN3O2 — CID 95141905
5-chloro-6-[[(2S,3R)-2-phenyloxan-3-yl]methylamino]pyridine-3-carboxamide (PubChem CID 95141905) has the molecular formula C18H20ClN3O2 and a molecular weight of 345.83 g/mol. Its IUPAC name is 5-chloro-6-[[(2S,3R)-2-phenyloxan-3-yl]methylamino]pyridine-3-carboxamide.
| Compound Name | 5-chloro-6-[[(2S,3R)-2-phenyloxan-3-yl]methylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 95141905 |
| Molecular Formula | C18H20ClN3O2 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 5-chloro-6-[[(2S,3R)-2-phenyloxan-3-yl]methylamino]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cnc(NC[C@H]2CCCO[C@@H]2c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C18H20ClN3O2/c19-15-9-14(17(20)23)11-22-18(15)21-10-13-7-4-8-24-16(13)12-5-2-1-3-6-12/h1-3,5-6,9,11,13,16H,4,7-8,10H2,(H2,20,23)(H,21,22)/t13-,16-/m1/s1 |
| InChIKey | GYINQSDUOCOLBG-CZUORRHYSA-N |
| XLogP | 3.41 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |