C19H23N3O2 — CID 129398613
1-(5-methyl-2-pyridinyl)-3-[[(2S,3S)-2-phenyloxan-3-yl]methyl]urea (PubChem CID 129398613) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 1-(5-methyl-2-pyridinyl)-3-[[(2S,3S)-2-phenyloxan-3-yl]methyl]urea.
| Compound Name | 1-(5-methyl-2-pyridinyl)-3-[[(2S,3S)-2-phenyloxan-3-yl]methyl]urea |
|---|---|
| PubChem CID | 129398613 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 1-(5-methyl-2-pyridinyl)-3-[[(2S,3S)-2-phenyloxan-3-yl]methyl]urea |
| SMILES | Cc1ccc(NC(=O)NC[C@@H]2CCCO[C@@H]2c2ccccc2)nc1 |
| InChI | InChI=1S/C19H23N3O2/c1-14-9-10-17(20-12-14)22-19(23)21-13-16-8-5-11-24-18(16)15-6-3-2-4-7-15/h2-4,6-7,9-10,12,16,18H,5,8,11,13H2,1H3,(H2,20,21,22,23)/t16-,18+/m0/s1 |
| InChIKey | YHWMHWZNYGMAEJ-FUHWJXTLSA-N |
| XLogP | 3.68 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |