C20H25N3O2 — CID 124832309
1-[[(2R,3R)-2-phenyloxan-3-yl]methyl]-3-[(1S)-1-pyridin-3-ylethyl]urea (PubChem CID 124832309) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 1-[[(2R,3R)-2-phenyloxan-3-yl]methyl]-3-[(1S)-1-pyridin-3-ylethyl]urea.
| Compound Name | 1-[[(2R,3R)-2-phenyloxan-3-yl]methyl]-3-[(1S)-1-pyridin-3-ylethyl]urea |
|---|---|
| PubChem CID | 124832309 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 1-[[(2R,3R)-2-phenyloxan-3-yl]methyl]-3-[(1S)-1-pyridin-3-ylethyl]urea |
| SMILES | C[C@H](NC(=O)NC[C@H]1CCCO[C@H]1c1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C20H25N3O2/c1-15(17-9-5-11-21-13-17)23-20(24)22-14-18-10-6-12-25-19(18)16-7-3-2-4-8-16/h2-5,7-9,11,13,15,18-19H,6,10,12,14H2,1H3,(H2,22,23,24)/t15-,18+,19-/m0/s1 |
| InChIKey | FHOONPAMCJABFX-IPELMVKDSA-N |
| XLogP | 3.61 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |