C20H24N2O3 — CID 124505433
1-[(1R)-2-hydroxy-1-phenylethyl]-3-[[(2R,3S)-2-phenyloxolan-3-yl]methyl]urea (PubChem CID 124505433) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is 1-[(1R)-2-hydroxy-1-phenylethyl]-3-[[(2R,3S)-2-phenyloxolan-3-yl]methyl]urea.
| Compound Name | 1-[(1R)-2-hydroxy-1-phenylethyl]-3-[[(2R,3S)-2-phenyloxolan-3-yl]methyl]urea |
|---|---|
| PubChem CID | 124505433 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 1-[(1R)-2-hydroxy-1-phenylethyl]-3-[[(2R,3S)-2-phenyloxolan-3-yl]methyl]urea |
| SMILES | O=C(NC[C@@H]1CCO[C@H]1c1ccccc1)N[C@@H](CO)c1ccccc1 |
| InChI | InChI=1S/C20H24N2O3/c23-14-18(15-7-3-1-4-8-15)22-20(24)21-13-17-11-12-25-19(17)16-9-5-2-6-10-16/h1-10,17-19,23H,11-14H2,(H2,21,22,24)/t17-,18-,19-/m0/s1 |
| InChIKey | FCUDWWXTBRNQAN-FHWLQOOXSA-N |
| XLogP | 2.80 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |