C16H19N3O3 — CID 129000845
1-(1,2-oxazol-3-ylmethyl)-3-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]urea (PubChem CID 129000845) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is 1-(1,2-oxazol-3-ylmethyl)-3-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]urea.
| Compound Name | 1-(1,2-oxazol-3-ylmethyl)-3-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]urea |
|---|---|
| PubChem CID | 129000845 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 1-(1,2-oxazol-3-ylmethyl)-3-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]urea |
| SMILES | O=C(NCc1ccon1)NC[C@H]1CCO[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H19N3O3/c20-16(18-11-14-7-9-22-19-14)17-10-13-6-8-21-15(13)12-4-2-1-3-5-12/h1-5,7,9,13,15H,6,8,10-11H2,(H2,17,18,20)/t13-,15-/m1/s1 |
| InChIKey | YKEAJXMZFCSZMS-UKRRQHHQSA-N |
| XLogP | 2.25 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |