C16H18N2O3 — CID 129002650
2-(1,2-oxazol-3-yl)-N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]acetamide (PubChem CID 129002650) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is 2-(1,2-oxazol-3-yl)-N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]acetamide.
| Compound Name | 2-(1,2-oxazol-3-yl)-N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 129002650 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 2-(1,2-oxazol-3-yl)-N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]acetamide |
| SMILES | O=C(Cc1ccon1)NC[C@H]1CCO[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H18N2O3/c19-15(10-14-7-9-21-18-14)17-11-13-6-8-20-16(13)12-4-2-1-3-5-12/h1-5,7,9,13,16H,6,8,10-11H2,(H,17,19)/t13-,16-/m1/s1 |
| InChIKey | OHIIUCSXHLMXSE-CZUORRHYSA-N |
| XLogP | 2.11 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |