C16H18N4O2 — CID 129003341
3-amino-N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]pyrazine-2-carboxamide (PubChem CID 129003341) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 3-amino-N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 129003341 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 3-amino-N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]pyrazine-2-carboxamide |
| SMILES | Nc1nccnc1C(=O)NC[C@H]1CCO[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H18N4O2/c17-15-13(18-7-8-19-15)16(21)20-10-12-6-9-22-14(12)11-4-2-1-3-5-11/h1-5,7-8,12,14H,6,9-10H2,(H2,17,19)(H,20,21)/t12-,14-/m1/s1 |
| InChIKey | USMYYDUGBFHXRR-TZMCWYRMSA-N |
| XLogP | 1.57 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |