C17H17NO5 — CID 120701801
5-[[(2R,3S)-2-phenyloxolan-3-yl]methylcarbamoyl]furan-3-carboxylic acid (PubChem CID 120701801) has the molecular formula C17H17NO5 and a molecular weight of 315.33 g/mol. Its IUPAC name is 5-[[(2R,3S)-2-phenyloxolan-3-yl]methylcarbamoyl]furan-3-carboxylic acid.
| Compound Name | 5-[[(2R,3S)-2-phenyloxolan-3-yl]methylcarbamoyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 120701801 |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 5-[[(2R,3S)-2-phenyloxolan-3-yl]methylcarbamoyl]furan-3-carboxylic acid |
| SMILES | O=C(O)c1coc(C(=O)NC[C@@H]2CCO[C@H]2c2ccccc2)c1 |
| InChI | InChI=1S/C17H17NO5/c19-16(14-8-13(10-23-14)17(20)21)18-9-12-6-7-22-15(12)11-4-2-1-3-5-11/h1-5,8,10,12,15H,6-7,9H2,(H,18,19)(H,20,21)/t12-,15-/m0/s1 |
| InChIKey | GOJYMTFQNQXLIC-WFASDCNBSA-N |
| XLogP | 2.49 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |