C16H17ClN2O2 — CID 129000910
4-chloro-N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]-1H-pyrrole-2-carboxamide (PubChem CID 129000910) has the molecular formula C16H17ClN2O2 and a molecular weight of 304.78 g/mol. Its IUPAC name is 4-chloro-N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-chloro-N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 129000910 |
| Molecular Formula | C16H17ClN2O2 |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 4-chloro-N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NC[C@H]1CCO[C@@H]1c1ccccc1)c1cc(Cl)c[nH]1 |
| InChI | InChI=1S/C16H17ClN2O2/c17-13-8-14(18-10-13)16(20)19-9-12-6-7-21-15(12)11-4-2-1-3-5-11/h1-5,8,10,12,15,18H,6-7,9H2,(H,19,20)/t12-,15-/m1/s1 |
| InChIKey | UFCZUZMWBAROHM-IUODEOHRSA-N |
| XLogP | 3.18 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |