C17H17FN2O2 — CID 129002144
3-fluoro-N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]pyridine-4-carboxamide (PubChem CID 129002144) has the molecular formula C17H17FN2O2 and a molecular weight of 300.33 g/mol. Its IUPAC name is 3-fluoro-N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]pyridine-4-carboxamide.
| Compound Name | 3-fluoro-N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 129002144 |
| Molecular Formula | C17H17FN2O2 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 3-fluoro-N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]pyridine-4-carboxamide |
| SMILES | O=C(NC[C@H]1CCO[C@@H]1c1ccccc1)c1ccncc1F |
| InChI | InChI=1S/C17H17FN2O2/c18-15-11-19-8-6-14(15)17(21)20-10-13-7-9-22-16(13)12-4-2-1-3-5-12/h1-6,8,11,13,16H,7,9-10H2,(H,20,21)/t13-,16-/m1/s1 |
| InChIKey | SQCUCHCZFCCDMH-CZUORRHYSA-N |
| XLogP | 2.73 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |