C19H22N2O2 — CID 129002179
N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]-2-pyridin-3-ylpropanamide (PubChem CID 129002179) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]-2-pyridin-3-ylpropanamide.
| Compound Name | N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]-2-pyridin-3-ylpropanamide |
|---|---|
| PubChem CID | 129002179 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]-2-pyridin-3-ylpropanamide |
| SMILES | CC(C(=O)NC[C@H]1CCO[C@@H]1c1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C19H22N2O2/c1-14(16-8-5-10-20-12-16)19(22)21-13-17-9-11-23-18(17)15-6-3-2-4-7-15/h2-8,10,12,14,17-18H,9,11,13H2,1H3,(H,21,22)/t14?,17-,18-/m1/s1 |
| InChIKey | YJEGTSSTNHVBGX-KNHHTTPFSA-N |
| XLogP | 3.08 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |