C18H22N2O2 — CID 129328039
(2S)-N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]-2-pyrrol-1-ylpropanamide (PubChem CID 129328039) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is (2S)-N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]-2-pyrrol-1-ylpropanamide.
| Compound Name | (2S)-N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]-2-pyrrol-1-ylpropanamide |
|---|---|
| PubChem CID | 129328039 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | (2S)-N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]-2-pyrrol-1-ylpropanamide |
| SMILES | C[C@@H](C(=O)NC[C@H]1CCO[C@@H]1c1ccccc1)n1cccc1 |
| InChI | InChI=1S/C18H22N2O2/c1-14(20-10-5-6-11-20)18(21)19-13-16-9-12-22-17(16)15-7-3-2-4-8-15/h2-8,10-11,14,16-17H,9,12-13H2,1H3,(H,19,21)/t14-,16+,17+/m0/s1 |
| InChIKey | XWIAEVYEWKMAJC-USXIJHARSA-N |
| XLogP | 2.94 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |