C18H18N2O4 — CID 120701781
4-[[(2S,3R)-2-phenyloxolan-3-yl]methylcarbamoyl]pyridine-2-carboxylic acid (PubChem CID 120701781) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 4-[[(2S,3R)-2-phenyloxolan-3-yl]methylcarbamoyl]pyridine-2-carboxylic acid.
| Compound Name | 4-[[(2S,3R)-2-phenyloxolan-3-yl]methylcarbamoyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 120701781 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 4-[[(2S,3R)-2-phenyloxolan-3-yl]methylcarbamoyl]pyridine-2-carboxylic acid |
| SMILES | O=C(NC[C@H]1CCO[C@@H]1c1ccccc1)c1ccnc(C(=O)O)c1 |
| InChI | InChI=1S/C18H18N2O4/c21-17(13-6-8-19-15(10-13)18(22)23)20-11-14-7-9-24-16(14)12-4-2-1-3-5-12/h1-6,8,10,14,16H,7,9,11H2,(H,20,21)(H,22,23)/t14-,16-/m1/s1 |
| InChIKey | AIQZUFLCQFREHW-GDBMZVCRSA-N |
| XLogP | 2.29 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |