C18H20N2O3 — CID 52511157
2-oxo-N-[[(2R,3R)-2-phenyloxan-3-yl]methyl]-1H-pyridine-3-carboxamide (PubChem CID 52511157) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is 2-oxo-N-[[(2R,3R)-2-phenyloxan-3-yl]methyl]-1H-pyridine-3-carboxamide.
| Compound Name | 2-oxo-N-[[(2R,3R)-2-phenyloxan-3-yl]methyl]-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 52511157 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 2-oxo-N-[[(2R,3R)-2-phenyloxan-3-yl]methyl]-1H-pyridine-3-carboxamide |
| SMILES | O=C(NC[C@H]1CCCO[C@H]1c1ccccc1)c1ccc[nH]c1=O |
| InChI | InChI=1S/C18H20N2O3/c21-17-15(9-4-10-19-17)18(22)20-12-14-8-5-11-23-16(14)13-6-2-1-3-7-13/h1-4,6-7,9-10,14,16H,5,8,11-12H2,(H,19,21)(H,20,22)/t14-,16+/m1/s1 |
| InChIKey | SWHHJXAESALJJE-ZBFHGGJFSA-N |
| XLogP | 2.27 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |