C18H27ClN2O2 — CID 119741526
N-[(2-phenyloxan-3-yl)methyl]-2-pyrrolidin-2-ylacetamide;hydrochloride (PubChem CID 119741526) has the molecular formula C18H27ClN2O2 and a molecular weight of 338.88 g/mol. Its IUPAC name is N-[(2-phenyloxan-3-yl)methyl]-2-pyrrolidin-2-ylacetamide;hydrochloride.
| Compound Name | N-[(2-phenyloxan-3-yl)methyl]-2-pyrrolidin-2-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119741526 |
| Molecular Formula | C18H27ClN2O2 |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | N-[(2-phenyloxan-3-yl)methyl]-2-pyrrolidin-2-ylacetamide;hydrochloride |
| SMILES | Cl.O=C(CC1CCCN1)NCC1CCCOC1c1ccccc1 |
| InChI | InChI=1S/C18H26N2O2.ClH/c21-17(12-16-9-4-10-19-16)20-13-15-8-5-11-22-18(15)14-6-2-1-3-7-14;/h1-3,6-7,15-16,18-19H,4-5,8-13H2,(H,20,21);1H |
| InChIKey | SBTHYHYXPMURQC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |