About 2-oxo-N-[(2S,3R)-2-phenyloxolan-3-yl]-1H-pyridine-3-carboxamide
2-oxo-N-[(2S,3R)-2-phenyloxolan-3-yl]-1H-pyridine-3-carboxamide (PubChem CID 96570780) has the molecular formula C16H16N2O3
and a molecular weight of 284.31 g/mol. Its IUPAC name is 2-oxo-N-[(2S,3R)-2-phenyloxolan-3-yl]-1H-pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 2-oxo-N-[(2S,3R)-2-phenyloxolan-3-yl]-1H-pyridine-3-carboxamide |
| PubChem CID | 96570780 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 2-oxo-N-[(2S,3R)-2-phenyloxolan-3-yl]-1H-pyridine-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCO[C@H]1c1ccccc1)c1ccc[nH]c1=O |
| InChI | InChI=1S/C16H16N2O3/c19-15-12(7-4-9-17-15)16(20)18-13-8-10-21-14(13)11-5-2-1-3-6-11/h1-7,9,13-14H,8,10H2,(H,17,19)(H,18,20)/t13-,14+/m1/s1 |
| InChIKey | IIXQIMWZDALIGT-KGLIPLIRSA-N |
| XLogP | 1.63 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-oxo-N-[(2S,3R)-2-phenyloxolan-3-yl]-1H-pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-N-[(2S,3R)-2-phenyloxolan-3-yl]-1H-pyridine-3-carboxamide?
The IUPAC name of 2-oxo-N-[(2S,3R)-2-phenyloxolan-3-yl]-1H-pyridine-3-carboxamide (CID 96570780) is 2-oxo-N-[(2S,3R)-2-phenyloxolan-3-yl]-1H-pyridine-3-carboxamide.
What is the SMILES notation for 2-oxo-N-[(2S,3R)-2-phenyloxolan-3-yl]-1H-pyridine-3-carboxamide?
The canonical SMILES for 2-oxo-N-[(2S,3R)-2-phenyloxolan-3-yl]-1H-pyridine-3-carboxamide is O=C(N[C@@H]1CCO[C@H]1c1ccccc1)c1ccc[nH]c1=O.
What is the InChIKey of 2-oxo-N-[(2S,3R)-2-phenyloxolan-3-yl]-1H-pyridine-3-carboxamide?
The InChIKey is IIXQIMWZDALIGT-KGLIPLIRSA-N. The full InChI is InChI=1S/C16H16N2O3/c19-15-12(7-4-9-17-15)16(20)18-13-8-10-21-14(13)11-5-2-1-3-6-11/h1-7,9,13-14H,8,10H2,(H,17,19)(H,18,20)/t13-,14+/m1/s1.
What are the key properties of 2-oxo-N-[(2S,3R)-2-phenyloxolan-3-yl]-1H-pyridine-3-carboxamide?
2-oxo-N-[(2S,3R)-2-phenyloxolan-3-yl]-1H-pyridine-3-carboxamide has a molecular weight of 284.31 g/mol, XLogP of 1.63, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-N-[(2S,3R)-2-phenyloxolan-3-yl]-1H-pyridine-3-carboxamide is sourced from PubChem (CID 96570780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).