C15H17ClN2 — CID 63683527
2-(2-bicyclo[2.2.1]heptanylmethylamino)-4-chlorobenzonitrile (PubChem CID 63683527) has the molecular formula C15H17ClN2 and a molecular weight of 260.77 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanylmethylamino)-4-chlorobenzonitrile.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanylmethylamino)-4-chlorobenzonitrile |
|---|---|
| PubChem CID | 63683527 |
| Molecular Formula | C15H17ClN2 |
| Molecular Weight | 260.77 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanylmethylamino)-4-chlorobenzonitrile |
| SMILES | N#Cc1ccc(Cl)cc1NCC1CC2CCC1C2 |
| InChI | InChI=1S/C15H17ClN2/c16-14-4-3-12(8-17)15(7-14)18-9-13-6-10-1-2-11(13)5-10/h3-4,7,10-11,13,18H,1-2,5-6,9H2 |
| InChIKey | GWGPMQHKYFHCPN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.77 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |