C19H19ClN4 — CID 100566790
6-chloro-4-N-(3,3-diphenylpropyl)pyrimidine-2,4-diamine (PubChem CID 100566790) has the molecular formula C19H19ClN4 and a molecular weight of 338.84 g/mol. Its IUPAC name is 6-chloro-4-N-(3,3-diphenylpropyl)pyrimidine-2,4-diamine.
| Compound Name | 6-chloro-4-N-(3,3-diphenylpropyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 100566790 |
| Molecular Formula | C19H19ClN4 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 6-chloro-4-N-(3,3-diphenylpropyl)pyrimidine-2,4-diamine |
| SMILES | Nc1nc(Cl)cc(NCCC(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C19H19ClN4/c20-17-13-18(24-19(21)23-17)22-12-11-16(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-10,13,16H,11-12H2,(H3,21,22,23,24) |
| InChIKey | SJCFOEVIHKVAAB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |