C15H17ClN6 — CID 134001512
6-chloro-4-N-[3-(2-methylbenzimidazol-1-yl)propyl]pyrimidine-2,4-diamine (PubChem CID 134001512) has the molecular formula C15H17ClN6 and a molecular weight of 316.80 g/mol. Its IUPAC name is 6-chloro-4-N-[3-(2-methylbenzimidazol-1-yl)propyl]pyrimidine-2,4-diamine.
| Compound Name | 6-chloro-4-N-[3-(2-methylbenzimidazol-1-yl)propyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 134001512 |
| Molecular Formula | C15H17ClN6 |
| Molecular Weight | 316.80 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 6-chloro-4-N-[3-(2-methylbenzimidazol-1-yl)propyl]pyrimidine-2,4-diamine |
| SMILES | Cc1nc2ccccc2n1CCCNc1cc(Cl)nc(N)n1 |
| InChI | InChI=1S/C15H17ClN6/c1-10-19-11-5-2-3-6-12(11)22(10)8-4-7-18-14-9-13(16)20-15(17)21-14/h2-3,5-6,9H,4,7-8H2,1H3,(H3,17,18,20,21) |
| InChIKey | YRPZFMOMNRVFAR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.80 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|