C16H16Cl2N4O — CID 78839389
4,5-dichloro-N-[3-(2-methylbenzimidazol-1-yl)propyl]-1H-pyrrole-2-carboxamide (PubChem CID 78839389) has the molecular formula C16H16Cl2N4O and a molecular weight of 351.24 g/mol. Its IUPAC name is 4,5-dichloro-N-[3-(2-methylbenzimidazol-1-yl)propyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4,5-dichloro-N-[3-(2-methylbenzimidazol-1-yl)propyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 78839389 |
| Molecular Formula | C16H16Cl2N4O |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 4,5-dichloro-N-[3-(2-methylbenzimidazol-1-yl)propyl]-1H-pyrrole-2-carboxamide |
| SMILES | Cc1nc2ccccc2n1CCCNC(=O)c1cc(Cl)c(Cl)[nH]1 |
| InChI | InChI=1S/C16H16Cl2N4O/c1-10-20-12-5-2-3-6-14(12)22(10)8-4-7-19-16(23)13-9-11(17)15(18)21-13/h2-3,5-6,9,21H,4,7-8H2,1H3,(H,19,23) |
| InChIKey | KDCVKGANVSUCOW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|