C12H12Cl2N4O — CID 52569320
(1S)-2-[(2-amino-6-chloropyrimidin-4-yl)amino]-1-(4-chlorophenyl)ethanol (PubChem CID 52569320) has the molecular formula C12H12Cl2N4O and a molecular weight of 299.16 g/mol. Its IUPAC name is (1S)-2-[(2-amino-6-chloropyrimidin-4-yl)amino]-1-(4-chlorophenyl)ethanol.
| Compound Name | (1S)-2-[(2-amino-6-chloropyrimidin-4-yl)amino]-1-(4-chlorophenyl)ethanol |
|---|---|
| PubChem CID | 52569320 |
| Molecular Formula | C12H12Cl2N4O |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | (1S)-2-[(2-amino-6-chloropyrimidin-4-yl)amino]-1-(4-chlorophenyl)ethanol |
| SMILES | Nc1nc(Cl)cc(NC[C@@H](O)c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C12H12Cl2N4O/c13-8-3-1-7(2-4-8)9(19)6-16-11-5-10(14)17-12(15)18-11/h1-5,9,19H,6H2,(H3,15,16,17,18)/t9-/m1/s1 |
| InChIKey | CGMBWXKTTRTGEW-SECBINFHSA-N |
| XLogP | 2.51 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |