C11H17ClN4O2 — CID 52538522
(2R)-1-[(2-amino-6-chloropyrimidin-4-yl)amino]-3-(cyclopropylmethoxy)propan-2-ol (PubChem CID 52538522) has the molecular formula C11H17ClN4O2 and a molecular weight of 272.74 g/mol. Its IUPAC name is (2R)-1-[(2-amino-6-chloropyrimidin-4-yl)amino]-3-(cyclopropylmethoxy)propan-2-ol.
| Compound Name | (2R)-1-[(2-amino-6-chloropyrimidin-4-yl)amino]-3-(cyclopropylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 52538522 |
| Molecular Formula | C11H17ClN4O2 |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | (2R)-1-[(2-amino-6-chloropyrimidin-4-yl)amino]-3-(cyclopropylmethoxy)propan-2-ol |
| SMILES | Nc1nc(Cl)cc(NC[C@@H](O)COCC2CC2)n1 |
| InChI | InChI=1S/C11H17ClN4O2/c12-9-3-10(16-11(13)15-9)14-4-8(17)6-18-5-7-1-2-7/h3,7-8,17H,1-2,4-6H2,(H3,13,14,15,16)/t8-/m1/s1 |
| InChIKey | CUQGTVQBSPFHOE-MRVPVSSYSA-N |
| XLogP | 0.91 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |