C12H12ClFN4O — CID 36790111
(1R)-2-[(2-amino-6-chloropyrimidin-4-yl)amino]-1-(4-fluorophenyl)ethanol (PubChem CID 36790111) has the molecular formula C12H12ClFN4O and a molecular weight of 282.71 g/mol. Its IUPAC name is (1R)-2-[(2-amino-6-chloropyrimidin-4-yl)amino]-1-(4-fluorophenyl)ethanol.
| Compound Name | (1R)-2-[(2-amino-6-chloropyrimidin-4-yl)amino]-1-(4-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 36790111 |
| Molecular Formula | C12H12ClFN4O |
| Molecular Weight | 282.71 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | (1R)-2-[(2-amino-6-chloropyrimidin-4-yl)amino]-1-(4-fluorophenyl)ethanol |
| SMILES | Nc1nc(Cl)cc(NC[C@H](O)c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C12H12ClFN4O/c13-10-5-11(18-12(15)17-10)16-6-9(19)7-1-3-8(14)4-2-7/h1-5,9,19H,6H2,(H3,15,16,17,18)/t9-/m0/s1 |
| InChIKey | PYTBRDPOPLRYEL-VIFPVBQESA-N |
| XLogP | 2.00 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.71 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |