C14H15ClFN5O — CID 95322125
(2S)-2-[[(2-amino-6-chloropyrimidin-4-yl)amino]methyl]-3-(4-fluorophenyl)propanamide (PubChem CID 95322125) has the molecular formula C14H15ClFN5O and a molecular weight of 323.76 g/mol. Its IUPAC name is (2S)-2-[[(2-amino-6-chloropyrimidin-4-yl)amino]methyl]-3-(4-fluorophenyl)propanamide.
| Compound Name | (2S)-2-[[(2-amino-6-chloropyrimidin-4-yl)amino]methyl]-3-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 95322125 |
| Molecular Formula | C14H15ClFN5O |
| Molecular Weight | 323.76 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | (2S)-2-[[(2-amino-6-chloropyrimidin-4-yl)amino]methyl]-3-(4-fluorophenyl)propanamide |
| SMILES | NC(=O)[C@H](CNc1cc(Cl)nc(N)n1)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C14H15ClFN5O/c15-11-6-12(21-14(18)20-11)19-7-9(13(17)22)5-8-1-3-10(16)4-2-8/h1-4,6,9H,5,7H2,(H2,17,22)(H3,18,19,20,21)/t9-/m0/s1 |
| InChIKey | GZDHVLSCPADOTM-VIFPVBQESA-N |
| XLogP | 1.61 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.76 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |