C15H14F4N4O — CID 95317473
(2S)-2-[(4-fluorophenyl)methyl]-3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]propanamide (PubChem CID 95317473) has the molecular formula C15H14F4N4O and a molecular weight of 342.30 g/mol. Its IUPAC name is (2S)-2-[(4-fluorophenyl)methyl]-3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]propanamide.
| Compound Name | (2S)-2-[(4-fluorophenyl)methyl]-3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]propanamide |
|---|---|
| PubChem CID | 95317473 |
| Molecular Formula | C15H14F4N4O |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | (2S)-2-[(4-fluorophenyl)methyl]-3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]propanamide |
| SMILES | NC(=O)[C@H](CNc1nccc(C(F)(F)F)n1)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C15H14F4N4O/c16-11-3-1-9(2-4-11)7-10(13(20)24)8-22-14-21-6-5-12(23-14)15(17,18)19/h1-6,10H,7-8H2,(H2,20,24)(H,21,22,23)/t10-/m0/s1 |
| InChIKey | CUJWYNLMJITFKT-JTQLQIEISA-N |
| XLogP | 2.39 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |