C15H14FN5O — CID 56826029
2-[[(3-cyanopyrazin-2-yl)amino]methyl]-3-(4-fluorophenyl)propanamide (PubChem CID 56826029) has the molecular formula C15H14FN5O and a molecular weight of 299.31 g/mol. Its IUPAC name is 2-[[(3-cyanopyrazin-2-yl)amino]methyl]-3-(4-fluorophenyl)propanamide.
| Compound Name | 2-[[(3-cyanopyrazin-2-yl)amino]methyl]-3-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 56826029 |
| Molecular Formula | C15H14FN5O |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-[[(3-cyanopyrazin-2-yl)amino]methyl]-3-(4-fluorophenyl)propanamide |
| SMILES | N#Cc1nccnc1NCC(Cc1ccc(F)cc1)C(N)=O |
| InChI | InChI=1S/C15H14FN5O/c16-12-3-1-10(2-4-12)7-11(14(18)22)9-21-15-13(8-17)19-5-6-20-15/h1-6,11H,7,9H2,(H2,18,22)(H,20,21) |
| InChIKey | YAHJKMRIKALNJI-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |