C17H17N3O3 — CID 133314409
methyl 2-[[(3-cyano-2-pyridinyl)amino]methyl]-3-(4-hydroxyphenyl)propanoate (PubChem CID 133314409) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is methyl 2-[[(3-cyano-2-pyridinyl)amino]methyl]-3-(4-hydroxyphenyl)propanoate.
| Compound Name | methyl 2-[[(3-cyano-2-pyridinyl)amino]methyl]-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 133314409 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | methyl 2-[[(3-cyano-2-pyridinyl)amino]methyl]-3-(4-hydroxyphenyl)propanoate |
| SMILES | COC(=O)C(CNc1ncccc1C#N)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C17H17N3O3/c1-23-17(22)14(9-12-4-6-15(21)7-5-12)11-20-16-13(10-18)3-2-8-19-16/h2-8,14,21H,9,11H2,1H3,(H,19,20) |
| InChIKey | LYDYXQJPQMFORR-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 95.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |